About ethane;4-(4-methylphenyl)cyclohepta-1,3-diene-1-carbonitrile
ethane;4-(4-methylphenyl)cyclohepta-1,3-diene-1-carbonitrile (PubChem CID 142006668) has the molecular formula C17H21N
and a molecular weight of 239.36 g/mol. Its IUPAC name is ethane;4-(4-methylphenyl)cyclohepta-1,3-diene-1-carbonitrile.
Molecular Properties
| Compound Name | ethane;4-(4-methylphenyl)cyclohepta-1,3-diene-1-carbonitrile |
| PubChem CID | 142006668 |
| Molecular Formula | C17H21N |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | ethane;4-(4-methylphenyl)cyclohepta-1,3-diene-1-carbonitrile |
| SMILES | CC.Cc1ccc(C2=CC=C(C#N)CCC2)cc1 |
| InChI | InChI=1S/C15H15N.C2H6/c1-12-5-8-15(9-6-12)14-4-2-3-13(11-16)7-10-14;1-2/h5-10H,2-4H2,1H3;1-2H3 |
| InChIKey | AUNFWZXPUSIHIW-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;4-(4-methylphenyl)cyclohepta-1,3-diene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-(4-methylphenyl)cyclohepta-1,3-diene-1-carbonitrile?
The IUPAC name of ethane;4-(4-methylphenyl)cyclohepta-1,3-diene-1-carbonitrile (CID 142006668) is ethane;4-(4-methylphenyl)cyclohepta-1,3-diene-1-carbonitrile.
What is the SMILES notation for ethane;4-(4-methylphenyl)cyclohepta-1,3-diene-1-carbonitrile?
The canonical SMILES for ethane;4-(4-methylphenyl)cyclohepta-1,3-diene-1-carbonitrile is CC.Cc1ccc(C2=CC=C(C#N)CCC2)cc1.
What is the InChIKey of ethane;4-(4-methylphenyl)cyclohepta-1,3-diene-1-carbonitrile?
The InChIKey is AUNFWZXPUSIHIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N.C2H6/c1-12-5-8-15(9-6-12)14-4-2-3-13(11-16)7-10-14;1-2/h5-10H,2-4H2,1H3;1-2H3.
What are the key properties of ethane;4-(4-methylphenyl)cyclohepta-1,3-diene-1-carbonitrile?
ethane;4-(4-methylphenyl)cyclohepta-1,3-diene-1-carbonitrile has a molecular weight of 239.36 g/mol, XLogP of 5.04, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-(4-methylphenyl)cyclohepta-1,3-diene-1-carbonitrile is sourced from PubChem (CID 142006668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).