C29H36N6O4S2 — CID 142006993
5-[3-[4,4-dimethyl-2-(2-methyl-4-nitrophenyl)imino-1,3-thiazolidin-3-yl]-2-methylprop-1-enyl]-3,4,4-trimethyl-N-(2-methyl-4-nitrophenyl)-1,3-thiazolidin-2-imine (PubChem CID 142006993) has the molecular formula C29H36N6O4S2 and a molecular weight of 596.78 g/mol. Its IUPAC name is 5-[3-[4,4-dimethyl-2-(2-methyl-4-nitrophenyl)imino-1,3-thiazolidin-3-yl]-2-methylprop-1-enyl]-3,4,4-trimethyl-N-(2-methyl-4-nitrophenyl)-1,3-thiazolidin-2-imine.
| Compound Name | 5-[3-[4,4-dimethyl-2-(2-methyl-4-nitrophenyl)imino-1,3-thiazolidin-3-yl]-2-methylprop-1-enyl]-3,4,4-trimethyl-N-(2-methyl-4-nitrophenyl)-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 142006993 |
| Molecular Formula | C29H36N6O4S2 |
| Molecular Weight | 596.78 g/mol |
| Exact Mass | 596.22 |
| IUPAC Name | 5-[3-[4,4-dimethyl-2-(2-methyl-4-nitrophenyl)imino-1,3-thiazolidin-3-yl]-2-methylprop-1-enyl]-3,4,4-trimethyl-N-(2-methyl-4-nitrophenyl)-1,3-thiazolidin-2-imine |
| SMILES | CC(=CC1S/C(=N\c2ccc([N+](=O)[O-])cc2C)N(C)C1(C)C)CN1/C(=N/c2ccc([N+](=O)[O-])cc2C)SCC1(C)C |
| InChI | InChI=1S/C29H36N6O4S2/c1-18(16-33-27(40-17-28(33,4)5)31-24-12-10-22(35(38)39)15-20(24)3)13-25-29(6,7)32(8)26(41-25)30-23-11-9-21(34(36)37)14-19(23)2/h9-15,25H,16-17H2,1-8H3/b18-13?,30-26-,31-27- |
| InChIKey | MTRQFVDDZBPLHP-ZZWBZOCJSA-N |
| XLogP | 7.39 |
| TPSA | 117.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.78 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|