C20H20N4O5S — CID 2406346
[2-(2,4-dimethylphenyl)imino-4,4-dimethyl-1,3-thiazolidin-3-yl]-(3,5-dinitrophenyl)methanone (PubChem CID 2406346) has the molecular formula C20H20N4O5S and a molecular weight of 428.47 g/mol. Its IUPAC name is [2-(2,4-dimethylphenyl)imino-4,4-dimethyl-1,3-thiazolidin-3-yl]-(3,5-dinitrophenyl)methanone.
| Compound Name | [2-(2,4-dimethylphenyl)imino-4,4-dimethyl-1,3-thiazolidin-3-yl]-(3,5-dinitrophenyl)methanone |
|---|---|
| PubChem CID | 2406346 |
| Molecular Formula | C20H20N4O5S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | [2-(2,4-dimethylphenyl)imino-4,4-dimethyl-1,3-thiazolidin-3-yl]-(3,5-dinitrophenyl)methanone |
| SMILES | Cc1ccc(/N=C2\SCC(C)(C)N2C(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)c(C)c1 |
| InChI | InChI=1S/C20H20N4O5S/c1-12-5-6-17(13(2)7-12)21-19-22(20(3,4)11-30-19)18(25)14-8-15(23(26)27)10-16(9-14)24(28)29/h5-10H,11H2,1-4H3/b21-19- |
| InChIKey | JJNBMMHHFCOIRP-VZCXRCSSSA-N |
| XLogP | 4.78 |
| TPSA | 118.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|