C18H26N4 — CID 142008369
2-[1-(3-aminopropyl)-4-(azetidin-2-yl)piperidin-4-yl]benzonitrile (PubChem CID 142008369) has the molecular formula C18H26N4 and a molecular weight of 298.43 g/mol. Its IUPAC name is 2-[1-(3-aminopropyl)-4-(azetidin-2-yl)piperidin-4-yl]benzonitrile.
| Compound Name | 2-[1-(3-aminopropyl)-4-(azetidin-2-yl)piperidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 142008369 |
| Molecular Formula | C18H26N4 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | 2-[1-(3-aminopropyl)-4-(azetidin-2-yl)piperidin-4-yl]benzonitrile |
| SMILES | N#Cc1ccccc1C1(C2CCN2)CCN(CCCN)CC1 |
| InChI | InChI=1S/C18H26N4/c19-9-3-11-22-12-7-18(8-13-22,17-6-10-21-17)16-5-2-1-4-15(16)14-20/h1-2,4-5,17,21H,3,6-13,19H2 |
| InChIKey | IUCAISXZIQOTNE-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 65.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |