C17H28 — CID 142012906
1-[(4Z)-2,6-dimethyl-3-methylidenehepta-4,6-dien-2-yl]-4-methylcyclohexane (PubChem CID 142012906) has the molecular formula C17H28 and a molecular weight of 232.41 g/mol. Its IUPAC name is 1-[(4Z)-2,6-dimethyl-3-methylidenehepta-4,6-dien-2-yl]-4-methylcyclohexane.
| Compound Name | 1-[(4Z)-2,6-dimethyl-3-methylidenehepta-4,6-dien-2-yl]-4-methylcyclohexane |
|---|---|
| PubChem CID | 142012906 |
| Molecular Formula | C17H28 |
| Molecular Weight | 232.41 g/mol |
| Exact Mass | 232.22 |
| IUPAC Name | 1-[(4Z)-2,6-dimethyl-3-methylidenehepta-4,6-dien-2-yl]-4-methylcyclohexane |
| SMILES | C=C(C)/C=C\C(=C)C(C)(C)C1CCC(C)CC1 |
| InChI | InChI=1S/C17H28/c1-13(2)7-10-15(4)17(5,6)16-11-8-14(3)9-12-16/h7,10,14,16H,1,4,8-9,11-12H2,2-3,5-6H3/b10-7- |
| InChIKey | DJVORLUHMADVEM-YFHOEESVSA-N |
| XLogP | 5.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.41 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|