C18H25N3O3S — CID 142015059
N-[3-[7-[(3S)-3-methylpyrrolidine-1-carbonyl]indol-1-yl]propyl]methanesulfonamide (PubChem CID 142015059) has the molecular formula C18H25N3O3S and a molecular weight of 363.48 g/mol. Its IUPAC name is N-[3-[7-[(3S)-3-methylpyrrolidine-1-carbonyl]indol-1-yl]propyl]methanesulfonamide.
| Compound Name | N-[3-[7-[(3S)-3-methylpyrrolidine-1-carbonyl]indol-1-yl]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 142015059 |
| Molecular Formula | C18H25N3O3S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | N-[3-[7-[(3S)-3-methylpyrrolidine-1-carbonyl]indol-1-yl]propyl]methanesulfonamide |
| SMILES | C[C@H]1CCN(C(=O)c2cccc3ccn(CCCNS(C)(=O)=O)c23)C1 |
| InChI | InChI=1S/C18H25N3O3S/c1-14-7-11-21(13-14)18(22)16-6-3-5-15-8-12-20(17(15)16)10-4-9-19-25(2,23)24/h3,5-6,8,12,14,19H,4,7,9-11,13H2,1-2H3/t14-/m0/s1 |
| InChIKey | YZSPSCFTHBTNQX-AWEZNQCLSA-N |
| XLogP | 2.06 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|