C15H20N4O4S2 — CID 142015971
1-methyl-1-(4-methyl-5-sulfamoyl-1,3-thiazol-2-yl)-3-(4-propoxyphenyl)urea (PubChem CID 142015971) has the molecular formula C15H20N4O4S2 and a molecular weight of 384.48 g/mol. Its IUPAC name is 1-methyl-1-(4-methyl-5-sulfamoyl-1,3-thiazol-2-yl)-3-(4-propoxyphenyl)urea.
| Compound Name | 1-methyl-1-(4-methyl-5-sulfamoyl-1,3-thiazol-2-yl)-3-(4-propoxyphenyl)urea |
|---|---|
| PubChem CID | 142015971 |
| Molecular Formula | C15H20N4O4S2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 1-methyl-1-(4-methyl-5-sulfamoyl-1,3-thiazol-2-yl)-3-(4-propoxyphenyl)urea |
| SMILES | CCCOc1ccc(NC(=O)N(C)c2nc(C)c(S(N)(=O)=O)s2)cc1 |
| InChI | InChI=1S/C15H20N4O4S2/c1-4-9-23-12-7-5-11(6-8-12)18-14(20)19(3)15-17-10(2)13(24-15)25(16,21)22/h5-8H,4,9H2,1-3H3,(H,18,20)(H2,16,21,22) |
| InChIKey | WOCNIPOZDFWWKU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |