C16H21N5O3S2 — CID 18344787
1-methyl-1-(4-methyl-5-sulfamoyl-1,3-thiazol-2-yl)-3-(4-pyrrolidin-1-ylphenyl)urea (PubChem CID 18344787) has the molecular formula C16H21N5O3S2 and a molecular weight of 395.51 g/mol. Its IUPAC name is 1-methyl-1-(4-methyl-5-sulfamoyl-1,3-thiazol-2-yl)-3-(4-pyrrolidin-1-ylphenyl)urea.
| Compound Name | 1-methyl-1-(4-methyl-5-sulfamoyl-1,3-thiazol-2-yl)-3-(4-pyrrolidin-1-ylphenyl)urea |
|---|---|
| PubChem CID | 18344787 |
| Molecular Formula | C16H21N5O3S2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 1-methyl-1-(4-methyl-5-sulfamoyl-1,3-thiazol-2-yl)-3-(4-pyrrolidin-1-ylphenyl)urea |
| SMILES | Cc1nc(N(C)C(=O)Nc2ccc(N3CCCC3)cc2)sc1S(N)(=O)=O |
| InChI | InChI=1S/C16H21N5O3S2/c1-11-14(26(17,23)24)25-16(18-11)20(2)15(22)19-12-5-7-13(8-6-12)21-9-3-4-10-21/h5-8H,3-4,9-10H2,1-2H3,(H,19,22)(H2,17,23,24) |
| InChIKey | RAGNZRFFDPXLKG-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 108.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|