C20H30N6O3S2 — CID 18344654
1-[2-(dimethylamino)ethyl]-1-[4-methyl-5-(methylsulfamoyl)-1,3-thiazol-2-yl]-3-(4-pyrrolidin-1-ylphenyl)urea (PubChem CID 18344654) has the molecular formula C20H30N6O3S2 and a molecular weight of 466.63 g/mol. Its IUPAC name is 1-[2-(dimethylamino)ethyl]-1-[4-methyl-5-(methylsulfamoyl)-1,3-thiazol-2-yl]-3-(4-pyrrolidin-1-ylphenyl)urea.
| Compound Name | 1-[2-(dimethylamino)ethyl]-1-[4-methyl-5-(methylsulfamoyl)-1,3-thiazol-2-yl]-3-(4-pyrrolidin-1-ylphenyl)urea |
|---|---|
| PubChem CID | 18344654 |
| Molecular Formula | C20H30N6O3S2 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | 1-[2-(dimethylamino)ethyl]-1-[4-methyl-5-(methylsulfamoyl)-1,3-thiazol-2-yl]-3-(4-pyrrolidin-1-ylphenyl)urea |
| SMILES | CNS(=O)(=O)c1sc(N(CCN(C)C)C(=O)Nc2ccc(N3CCCC3)cc2)nc1C |
| InChI | InChI=1S/C20H30N6O3S2/c1-15-18(31(28,29)21-2)30-20(22-15)26(14-13-24(3)4)19(27)23-16-7-9-17(10-8-16)25-11-5-6-12-25/h7-10,21H,5-6,11-14H2,1-4H3,(H,23,27) |
| InChIKey | NPRQDUUFFQVYRW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 97.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|