C19H23F3N5OTl — CID 142016387
[4-[4-[4-[[4-(trifluoromethyl)phenyl]carbamoyl]piperazin-1-yl]butyl]imidazol-1-yl]thallium (PubChem CID 142016387) has the molecular formula C19H23F3N5OTl and a molecular weight of 598.80 g/mol. Its IUPAC name is [4-[4-[4-[[4-(trifluoromethyl)phenyl]carbamoyl]piperazin-1-yl]butyl]imidazol-1-yl]thallium.
| Compound Name | [4-[4-[4-[[4-(trifluoromethyl)phenyl]carbamoyl]piperazin-1-yl]butyl]imidazol-1-yl]thallium |
|---|---|
| PubChem CID | 142016387 |
| Molecular Formula | C19H23F3N5OTl |
| Molecular Weight | 598.80 g/mol |
| Exact Mass | 599.16 |
| IUPAC Name | [4-[4-[4-[[4-(trifluoromethyl)phenyl]carbamoyl]piperazin-1-yl]butyl]imidazol-1-yl]thallium |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)N1CCN(CCCCc2cn([Tl])cn2)CC1 |
| InChI | InChI=1S/C19H24F3N5O.Tl/c20-19(21,22)15-4-6-16(7-5-15)25-18(28)27-11-9-26(10-12-27)8-2-1-3-17-13-23-14-24-17;/h4-7,13-14H,1-3,8-12H2,(H2,23,24,25,28);/q;+1/p-1 |
| InChIKey | KWPPQDLESQNSQE-UHFFFAOYSA-M |
| XLogP | 3.01 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.80 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|