About 2-bromo-N-iodoaniline
2-bromo-N-iodoaniline (PubChem CID 142016929) has the molecular formula C6H5BrIN
and a molecular weight of 297.92 g/mol. Its IUPAC name is 2-bromo-N-iodoaniline.
Molecular Properties
| Compound Name | 2-bromo-N-iodoaniline |
| PubChem CID | 142016929 |
| Molecular Formula | C6H5BrIN |
| Molecular Weight | 297.92 g/mol |
| Exact Mass | 296.87 |
| IUPAC Name | 2-bromo-N-iodoaniline |
| SMILES | Brc1ccccc1NI |
| InChI | InChI=1S/C6H5BrIN/c7-5-3-1-2-4-6(5)9-8/h1-4,9H |
| InChIKey | IRVRXMKYIIXYQP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.92 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-N-iodoaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-N-iodoaniline?
The IUPAC name of 2-bromo-N-iodoaniline (CID 142016929) is 2-bromo-N-iodoaniline.
What is the SMILES notation for 2-bromo-N-iodoaniline?
The canonical SMILES for 2-bromo-N-iodoaniline is Brc1ccccc1NI.
What is the InChIKey of 2-bromo-N-iodoaniline?
The InChIKey is IRVRXMKYIIXYQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5BrIN/c7-5-3-1-2-4-6(5)9-8/h1-4,9H.
What are the key properties of 2-bromo-N-iodoaniline?
2-bromo-N-iodoaniline has a molecular weight of 297.92 g/mol, XLogP of 3.21, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-N-iodoaniline is sourced from PubChem (CID 142016929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).