C9H12O2 — CID 14201809
(1S,8R)-bicyclo[6.1.0]nonane-4,5-dione (PubChem CID 14201809) has the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. Its IUPAC name is (1S,8R)-bicyclo[6.1.0]nonane-4,5-dione.
| Compound Name | (1S,8R)-bicyclo[6.1.0]nonane-4,5-dione |
|---|---|
| PubChem CID | 14201809 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | (1S,8R)-bicyclo[6.1.0]nonane-4,5-dione |
| SMILES | O=C1CC[C@@H]2C[C@@H]2CCC1=O |
| InChI | InChI=1S/C9H12O2/c10-8-3-1-6-5-7(6)2-4-9(8)11/h6-7H,1-5H2/t6-,7+ |
| InChIKey | ISLHCZZZIVYMJA-KNVOCYPGSA-N |
| XLogP | 1.33 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|