C20H22Cl2N2O — CID 142018497
3-cyclopentyl-2-(3,4-dichlorophenyl)-2-methyl-N-pyridin-2-ylpropanamide (PubChem CID 142018497) has the molecular formula C20H22Cl2N2O and a molecular weight of 377.31 g/mol. Its IUPAC name is 3-cyclopentyl-2-(3,4-dichlorophenyl)-2-methyl-N-pyridin-2-ylpropanamide.
| Compound Name | 3-cyclopentyl-2-(3,4-dichlorophenyl)-2-methyl-N-pyridin-2-ylpropanamide |
|---|---|
| PubChem CID | 142018497 |
| Molecular Formula | C20H22Cl2N2O |
| Molecular Weight | 377.31 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 3-cyclopentyl-2-(3,4-dichlorophenyl)-2-methyl-N-pyridin-2-ylpropanamide |
| SMILES | CC(CC1CCCC1)(C(=O)Nc1ccccn1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H22Cl2N2O/c1-20(13-14-6-2-3-7-14,15-9-10-16(21)17(22)12-15)19(25)24-18-8-4-5-11-23-18/h4-5,8-12,14H,2-3,6-7,13H2,1H3,(H,23,24,25) |
| InChIKey | SQJALSUHEVRADI-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.31 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |