C16H27N — CID 142022786
6,7-bis(ethenyl)-3,3-dimethylazepine;ethane (PubChem CID 142022786) has the molecular formula C16H27N and a molecular weight of 233.40 g/mol. Its IUPAC name is 6,7-bis(ethenyl)-3,3-dimethylazepine;ethane.
| Compound Name | 6,7-bis(ethenyl)-3,3-dimethylazepine;ethane |
|---|---|
| PubChem CID | 142022786 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | 6,7-bis(ethenyl)-3,3-dimethylazepine;ethane |
| SMILES | C=CC1=C(C=C)N=CC(C)(C)C=C1.CC.CC |
| InChI | InChI=1S/C12H15N.2C2H6/c1-5-10-7-8-12(3,4)9-13-11(10)6-2;2*1-2/h5-9H,1-2H2,3-4H3;2*1-2H3 |
| InChIKey | ORYMMZQCWAHIRI-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |