C27H31N3O4S — CID 142023210
2-[7-(benzylamino)-2-[(4-methoxyphenyl)methyl]-3-oxo-1,4-benzothiazin-4-yl]-N-hydroxyacetamide;ethane (PubChem CID 142023210) has the molecular formula C27H31N3O4S and a molecular weight of 493.63 g/mol. Its IUPAC name is 2-[7-(benzylamino)-2-[(4-methoxyphenyl)methyl]-3-oxo-1,4-benzothiazin-4-yl]-N-hydroxyacetamide;ethane.
| Compound Name | 2-[7-(benzylamino)-2-[(4-methoxyphenyl)methyl]-3-oxo-1,4-benzothiazin-4-yl]-N-hydroxyacetamide;ethane |
|---|---|
| PubChem CID | 142023210 |
| Molecular Formula | C27H31N3O4S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | 2-[7-(benzylamino)-2-[(4-methoxyphenyl)methyl]-3-oxo-1,4-benzothiazin-4-yl]-N-hydroxyacetamide;ethane |
| SMILES | CC.COc1ccc(CC2Sc3cc(NCc4ccccc4)ccc3N(CC(=O)NO)C2=O)cc1 |
| InChI | InChI=1S/C25H25N3O4S.C2H6/c1-32-20-10-7-17(8-11-20)13-23-25(30)28(16-24(29)27-31)21-12-9-19(14-22(21)33-23)26-15-18-5-3-2-4-6-18;1-2/h2-12,14,23,26,31H,13,15-16H2,1H3,(H,27,29);1-2H3 |
| InChIKey | ACSCAFHZUKVXNG-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|