C35H34N4O8S2 — CID 160866942
N-hydroxy-2-[2-[(4-hydroxyphenyl)methyl]-3-oxo-1,4-benzothiazin-4-yl]acetamide;N-hydroxy-2-[2-[(4-methoxyphenyl)methyl]-3-oxo-1,4-benzothiazin-4-yl]acetamide (PubChem CID 160866942) has the molecular formula C35H34N4O8S2 and a molecular weight of 702.81 g/mol. Its IUPAC name is N-hydroxy-2-[2-[(4-hydroxyphenyl)methyl]-3-oxo-1,4-benzothiazin-4-yl]acetamide;N-hydroxy-2-[2-[(4-methoxyphenyl)methyl]-3-oxo-1,4-benzothiazin-4-yl]acetamide.
| Compound Name | N-hydroxy-2-[2-[(4-hydroxyphenyl)methyl]-3-oxo-1,4-benzothiazin-4-yl]acetamide;N-hydroxy-2-[2-[(4-methoxyphenyl)methyl]-3-oxo-1,4-benzothiazin-4-yl]acetamide |
|---|---|
| PubChem CID | 160866942 |
| Molecular Formula | C35H34N4O8S2 |
| Molecular Weight | 702.81 g/mol |
| Exact Mass | 702.18 |
| IUPAC Name | N-hydroxy-2-[2-[(4-hydroxyphenyl)methyl]-3-oxo-1,4-benzothiazin-4-yl]acetamide;N-hydroxy-2-[2-[(4-methoxyphenyl)methyl]-3-oxo-1,4-benzothiazin-4-yl]acetamide |
| SMILES | COc1ccc(CC2Sc3ccccc3N(CC(=O)NO)C2=O)cc1.O=C(CN1C(=O)C(Cc2ccc(O)cc2)Sc2ccccc21)NO |
| InChI | InChI=1S/C18H18N2O4S.C17H16N2O4S/c1-24-13-8-6-12(7-9-13)10-16-18(22)20(11-17(21)19-23)14-4-2-3-5-15(14)25-16;20-12-7-5-11(6-8-12)9-15-17(22)19(10-16(21)18-23)13-3-1-2-4-14(13)24-15/h2-9,16,23H,10-11H2,1H3,(H,19,21);1-8,15,20,23H,9-10H2,(H,18,21) |
| InChIKey | SLFWCKQEUHAIES-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 168.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.81 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|