C19H18N6O4S — CID 21303134
N-hydroxy-2-[2-[(4-methoxyphenyl)methyl]-3-oxo-6-(2H-tetrazol-5-yl)-1,4-benzothiazin-4-yl]acetamide (PubChem CID 21303134) has the molecular formula C19H18N6O4S and a molecular weight of 426.46 g/mol. Its IUPAC name is N-hydroxy-2-[2-[(4-methoxyphenyl)methyl]-3-oxo-6-(2H-tetrazol-5-yl)-1,4-benzothiazin-4-yl]acetamide.
| Compound Name | N-hydroxy-2-[2-[(4-methoxyphenyl)methyl]-3-oxo-6-(2H-tetrazol-5-yl)-1,4-benzothiazin-4-yl]acetamide |
|---|---|
| PubChem CID | 21303134 |
| Molecular Formula | C19H18N6O4S |
| Molecular Weight | 426.46 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | N-hydroxy-2-[2-[(4-methoxyphenyl)methyl]-3-oxo-6-(2H-tetrazol-5-yl)-1,4-benzothiazin-4-yl]acetamide |
| SMILES | COc1ccc(CC2Sc3ccc(-c4nn[nH]n4)cc3N(CC(=O)NO)C2=O)cc1 |
| InChI | InChI=1S/C19H18N6O4S/c1-29-13-5-2-11(3-6-13)8-16-19(27)25(10-17(26)22-28)14-9-12(4-7-15(14)30-16)18-20-23-24-21-18/h2-7,9,16,28H,8,10H2,1H3,(H,22,26)(H,20,21,23,24) |
| InChIKey | RNJRXDAOECNQSC-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 133.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.46 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|