C21H23Cl2N3O3S — CID 142025006
4-[[1-(chloromethyl)indol-5-yl]sulfonylamino]-N-(3-chloropentan-3-yl)benzamide (PubChem CID 142025006) has the molecular formula C21H23Cl2N3O3S and a molecular weight of 468.41 g/mol. Its IUPAC name is 4-[[1-(chloromethyl)indol-5-yl]sulfonylamino]-N-(3-chloropentan-3-yl)benzamide.
| Compound Name | 4-[[1-(chloromethyl)indol-5-yl]sulfonylamino]-N-(3-chloropentan-3-yl)benzamide |
|---|---|
| PubChem CID | 142025006 |
| Molecular Formula | C21H23Cl2N3O3S |
| Molecular Weight | 468.41 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | 4-[[1-(chloromethyl)indol-5-yl]sulfonylamino]-N-(3-chloropentan-3-yl)benzamide |
| SMILES | CCC(Cl)(CC)NC(=O)c1ccc(NS(=O)(=O)c2ccc3c(ccn3CCl)c2)cc1 |
| InChI | InChI=1S/C21H23Cl2N3O3S/c1-3-21(23,4-2)24-20(27)15-5-7-17(8-6-15)25-30(28,29)18-9-10-19-16(13-18)11-12-26(19)14-22/h5-13,25H,3-4,14H2,1-2H3,(H,24,27) |
| InChIKey | YZOHACCUHZIWAK-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.41 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|