C21H24FN3O3S — CID 18343238
4-[(1-ethylindol-5-yl)sulfonylamino]-N-(1-fluoro-2-methylpropan-2-yl)benzamide (PubChem CID 18343238) has the molecular formula C21H24FN3O3S and a molecular weight of 417.51 g/mol. Its IUPAC name is 4-[(1-ethylindol-5-yl)sulfonylamino]-N-(1-fluoro-2-methylpropan-2-yl)benzamide.
| Compound Name | 4-[(1-ethylindol-5-yl)sulfonylamino]-N-(1-fluoro-2-methylpropan-2-yl)benzamide |
|---|---|
| PubChem CID | 18343238 |
| Molecular Formula | C21H24FN3O3S |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 4-[(1-ethylindol-5-yl)sulfonylamino]-N-(1-fluoro-2-methylpropan-2-yl)benzamide |
| SMILES | CCn1ccc2cc(S(=O)(=O)Nc3ccc(C(=O)NC(C)(C)CF)cc3)ccc21 |
| InChI | InChI=1S/C21H24FN3O3S/c1-4-25-12-11-16-13-18(9-10-19(16)25)29(27,28)24-17-7-5-15(6-8-17)20(26)23-21(2,3)14-22/h5-13,24H,4,14H2,1-3H3,(H,23,26) |
| InChIKey | GMTLQKOIXQLENS-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |