C10H20N2 — CID 142025962
(Z)-2-N,3-dimethyl-4-N-methylidenepent-3-ene-2,4-diimine;ethane (PubChem CID 142025962) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is (Z)-2-N,3-dimethyl-4-N-methylidenepent-3-ene-2,4-diimine;ethane.
| Compound Name | (Z)-2-N,3-dimethyl-4-N-methylidenepent-3-ene-2,4-diimine;ethane |
|---|---|
| PubChem CID | 142025962 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | (Z)-2-N,3-dimethyl-4-N-methylidenepent-3-ene-2,4-diimine;ethane |
| SMILES | C=N/C(C)=C(C)\C(C)=N\C.CC |
| InChI | InChI=1S/C8H14N2.C2H6/c1-6(7(2)9-4)8(3)10-5;1-2/h4H2,1-3,5H3;1-2H3/b7-6-,10-8+; |
| InChIKey | VUQARWADISHFCB-ZGSKTAACSA-N |
| XLogP | 3.10 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|