C13H21NO — CID 142028461
3-[[(2E)-2-ethenylpenta-2,4-dienoxy]methyl]piperidine (PubChem CID 142028461) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is 3-[[(2E)-2-ethenylpenta-2,4-dienoxy]methyl]piperidine.
| Compound Name | 3-[[(2E)-2-ethenylpenta-2,4-dienoxy]methyl]piperidine |
|---|---|
| PubChem CID | 142028461 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 3-[[(2E)-2-ethenylpenta-2,4-dienoxy]methyl]piperidine |
| SMILES | C=C/C=C(\C=C)COCC1CCCNC1 |
| InChI | InChI=1S/C13H21NO/c1-3-6-12(4-2)10-15-11-13-7-5-8-14-9-13/h3-4,6,13-14H,1-2,5,7-11H2/b12-6+ |
| InChIKey | QULLYIRWYOLJOS-WUXMJOGZSA-N |
| XLogP | 2.30 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|