C12H19NO — CID 143089643
(3R)-3-(cyclohexa-1,5-dien-1-yloxymethyl)piperidine (PubChem CID 143089643) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is (3R)-3-(cyclohexa-1,5-dien-1-yloxymethyl)piperidine.
| Compound Name | (3R)-3-(cyclohexa-1,5-dien-1-yloxymethyl)piperidine |
|---|---|
| PubChem CID | 143089643 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | (3R)-3-(cyclohexa-1,5-dien-1-yloxymethyl)piperidine |
| SMILES | C1=CC(OC[C@@H]2CCCNC2)=CCC1 |
| InChI | InChI=1S/C12H19NO/c1-2-6-12(7-3-1)14-10-11-5-4-8-13-9-11/h2,6-7,11,13H,1,3-5,8-10H2/t11-/m1/s1 |
| InChIKey | SISAKZLNRKYEKL-LLVKDONJSA-N |
| XLogP | 2.24 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |