C22H43NO — CID 143089618
ethane;3-[[(2E,4E)-5-ethenyl-6-methylocta-2,4-dien-3-yl]oxymethyl]piperidine;propane (PubChem CID 143089618) has the molecular formula C22H43NO and a molecular weight of 337.59 g/mol. Its IUPAC name is ethane;3-[[(2E,4E)-5-ethenyl-6-methylocta-2,4-dien-3-yl]oxymethyl]piperidine;propane.
| Compound Name | ethane;3-[[(2E,4E)-5-ethenyl-6-methylocta-2,4-dien-3-yl]oxymethyl]piperidine;propane |
|---|---|
| PubChem CID | 143089618 |
| Molecular Formula | C22H43NO |
| Molecular Weight | 337.59 g/mol |
| Exact Mass | 337.33 |
| IUPAC Name | ethane;3-[[(2E,4E)-5-ethenyl-6-methylocta-2,4-dien-3-yl]oxymethyl]piperidine;propane |
| SMILES | C=C/C(=C\C(=C/C)OCC1CCCNC1)C(C)CC.CC.CCC |
| InChI | InChI=1S/C17H29NO.C3H8.C2H6/c1-5-14(4)16(6-2)11-17(7-3)19-13-15-9-8-10-18-12-15;1-3-2;1-2/h6-7,11,14-15,18H,2,5,8-10,12-13H2,1,3-4H3;3H2,1-2H3;1-2H3/b16-11+,17-7+;; |
| InChIKey | OTTKNTHYJHPGAV-JULPXODSSA-N |
| XLogP | 6.51 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.59 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|