C12H18FNO — CID 143089574
3-[(5-fluorocyclohexa-1,5-dien-1-yl)oxymethyl]piperidine (PubChem CID 143089574) has the molecular formula C12H18FNO and a molecular weight of 211.28 g/mol. Its IUPAC name is 3-[(5-fluorocyclohexa-1,5-dien-1-yl)oxymethyl]piperidine.
| Compound Name | 3-[(5-fluorocyclohexa-1,5-dien-1-yl)oxymethyl]piperidine |
|---|---|
| PubChem CID | 143089574 |
| Molecular Formula | C12H18FNO |
| Molecular Weight | 211.28 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | 3-[(5-fluorocyclohexa-1,5-dien-1-yl)oxymethyl]piperidine |
| SMILES | FC1=CC(OCC2CCCNC2)=CCC1 |
| InChI | InChI=1S/C12H18FNO/c13-11-4-1-5-12(7-11)15-9-10-3-2-6-14-8-10/h5,7,10,14H,1-4,6,8-9H2 |
| InChIKey | JVPZYKFNBSTZDS-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.28 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |