C14H24FNO — CID 143759830
4-[2-[(2E,4E)-3-fluorohepta-2,4-dien-4-yl]oxyethyl]piperidine (PubChem CID 143759830) has the molecular formula C14H24FNO and a molecular weight of 241.35 g/mol. Its IUPAC name is 4-[2-[(2E,4E)-3-fluorohepta-2,4-dien-4-yl]oxyethyl]piperidine.
| Compound Name | 4-[2-[(2E,4E)-3-fluorohepta-2,4-dien-4-yl]oxyethyl]piperidine |
|---|---|
| PubChem CID | 143759830 |
| Molecular Formula | C14H24FNO |
| Molecular Weight | 241.35 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | 4-[2-[(2E,4E)-3-fluorohepta-2,4-dien-4-yl]oxyethyl]piperidine |
| SMILES | C/C=C(F)\C(=C/CC)OCCC1CCNCC1 |
| InChI | InChI=1S/C14H24FNO/c1-3-5-14(13(15)4-2)17-11-8-12-6-9-16-10-7-12/h4-5,12,16H,3,6-11H2,1-2H3/b13-4+,14-5+ |
| InChIKey | PNXPLZAMTCYSPT-PCSLFHOQSA-N |
| XLogP | 3.56 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.35 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|