C16H30FNO — CID 143759829
ethane;4-[2-[(2E,4E)-3-fluorohepta-2,4-dien-4-yl]oxyethyl]piperidine (PubChem CID 143759829) has the molecular formula C16H30FNO and a molecular weight of 271.42 g/mol. Its IUPAC name is ethane;4-[2-[(2E,4E)-3-fluorohepta-2,4-dien-4-yl]oxyethyl]piperidine.
| Compound Name | ethane;4-[2-[(2E,4E)-3-fluorohepta-2,4-dien-4-yl]oxyethyl]piperidine |
|---|---|
| PubChem CID | 143759829 |
| Molecular Formula | C16H30FNO |
| Molecular Weight | 271.42 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | ethane;4-[2-[(2E,4E)-3-fluorohepta-2,4-dien-4-yl]oxyethyl]piperidine |
| SMILES | C/C=C(F)\C(=C/CC)OCCC1CCNCC1.CC |
| InChI | InChI=1S/C14H24FNO.C2H6/c1-3-5-14(13(15)4-2)17-11-8-12-6-9-16-10-7-12;1-2/h4-5,12,16H,3,6-11H2,1-2H3;1-2H3/b13-4+,14-5+; |
| InChIKey | VNIVATBKFONOGU-SBYRGWOTSA-N |
| XLogP | 4.59 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.42 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|