C15H25NO — CID 91060293
4-[2-(6-methylhepta-1,3,5-trien-3-yloxy)ethyl]piperidine (PubChem CID 91060293) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is 4-[2-(6-methylhepta-1,3,5-trien-3-yloxy)ethyl]piperidine.
| Compound Name | 4-[2-(6-methylhepta-1,3,5-trien-3-yloxy)ethyl]piperidine |
|---|---|
| PubChem CID | 91060293 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 4-[2-(6-methylhepta-1,3,5-trien-3-yloxy)ethyl]piperidine |
| SMILES | C=CC(=CC=C(C)C)OCCC1CCNCC1 |
| InChI | InChI=1S/C15H25NO/c1-4-15(6-5-13(2)3)17-12-9-14-7-10-16-11-8-14/h4-6,14,16H,1,7-12H2,2-3H3 |
| InChIKey | PBBJBVHKJZHUKG-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|