C13H21NO — CID 166104770
3-[[(3E)-4-methylhexa-1,3,5-trien-3-yl]oxymethyl]piperidine (PubChem CID 166104770) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is 3-[[(3E)-4-methylhexa-1,3,5-trien-3-yl]oxymethyl]piperidine.
| Compound Name | 3-[[(3E)-4-methylhexa-1,3,5-trien-3-yl]oxymethyl]piperidine |
|---|---|
| PubChem CID | 166104770 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 3-[[(3E)-4-methylhexa-1,3,5-trien-3-yl]oxymethyl]piperidine |
| SMILES | C=C/C(C)=C(\C=C)OCC1CCCNC1 |
| InChI | InChI=1S/C13H21NO/c1-4-11(3)13(5-2)15-10-12-7-6-8-14-9-12/h4-5,12,14H,1-2,6-10H2,3H3/b13-11+ |
| InChIKey | JLQVRJCGJBADGG-ACCUITESSA-N |
| XLogP | 2.65 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|