C11H18FNO — CID 102648244
4-[3,4-dihydro-2H-pyran-6-yl(fluoro)methyl]piperidine (PubChem CID 102648244) has the molecular formula C11H18FNO and a molecular weight of 199.27 g/mol. Its IUPAC name is 4-[3,4-dihydro-2H-pyran-6-yl(fluoro)methyl]piperidine.
| Compound Name | 4-[3,4-dihydro-2H-pyran-6-yl(fluoro)methyl]piperidine |
|---|---|
| PubChem CID | 102648244 |
| Molecular Formula | C11H18FNO |
| Molecular Weight | 199.27 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | 4-[3,4-dihydro-2H-pyran-6-yl(fluoro)methyl]piperidine |
| SMILES | FC(C1=CCCCO1)C1CCNCC1 |
| InChI | InChI=1S/C11H18FNO/c12-11(9-4-6-13-7-5-9)10-3-1-2-8-14-10/h3,9,11,13H,1-2,4-8H2 |
| InChIKey | PYUIUMKEFFTGGJ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.27 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |