C21H23Cl2N3OS — CID 142028632
6-chloro-N-[1-[2-(3-chlorophenyl)-2-methylpropyl]-3-methyl-2-sulfanylidenepyrrolidin-3-yl]pyridine-2-carboxamide (PubChem CID 142028632) has the molecular formula C21H23Cl2N3OS and a molecular weight of 436.41 g/mol. Its IUPAC name is 6-chloro-N-[1-[2-(3-chlorophenyl)-2-methylpropyl]-3-methyl-2-sulfanylidenepyrrolidin-3-yl]pyridine-2-carboxamide.
| Compound Name | 6-chloro-N-[1-[2-(3-chlorophenyl)-2-methylpropyl]-3-methyl-2-sulfanylidenepyrrolidin-3-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 142028632 |
| Molecular Formula | C21H23Cl2N3OS |
| Molecular Weight | 436.41 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | 6-chloro-N-[1-[2-(3-chlorophenyl)-2-methylpropyl]-3-methyl-2-sulfanylidenepyrrolidin-3-yl]pyridine-2-carboxamide |
| SMILES | CC1(NC(=O)c2cccc(Cl)n2)CCN(CC(C)(C)c2cccc(Cl)c2)C1=S |
| InChI | InChI=1S/C21H23Cl2N3OS/c1-20(2,14-6-4-7-15(22)12-14)13-26-11-10-21(3,19(26)28)25-18(27)16-8-5-9-17(23)24-16/h4-9,12H,10-11,13H2,1-3H3,(H,25,27) |
| InChIKey | PXZXZDSTVRPMOH-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.41 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|