C15H19Cl2NO — CID 168506959
4-(chloromethyl)-1-[2-(3-chlorophenyl)-2-methylpropyl]pyrrolidin-2-one (PubChem CID 168506959) has the molecular formula C15H19Cl2NO and a molecular weight of 300.23 g/mol. Its IUPAC name is 4-(chloromethyl)-1-[2-(3-chlorophenyl)-2-methylpropyl]pyrrolidin-2-one.
| Compound Name | 4-(chloromethyl)-1-[2-(3-chlorophenyl)-2-methylpropyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 168506959 |
| Molecular Formula | C15H19Cl2NO |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 4-(chloromethyl)-1-[2-(3-chlorophenyl)-2-methylpropyl]pyrrolidin-2-one |
| SMILES | CC(C)(CN1CC(CCl)CC1=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H19Cl2NO/c1-15(2,12-4-3-5-13(17)7-12)10-18-9-11(8-16)6-14(18)19/h3-5,7,11H,6,8-10H2,1-2H3 |
| InChIKey | YPTUARMCKLEYHR-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|