C20H20ClN3O2 — CID 57288281
6-chloro-N-[(3R)-1-[(1S)-2,3-dihydro-1H-inden-1-yl]-3-methyl-2-oxopyrrolidin-3-yl]pyridine-2-carboxamide (PubChem CID 57288281) has the molecular formula C20H20ClN3O2 and a molecular weight of 369.85 g/mol. Its IUPAC name is 6-chloro-N-[(3R)-1-[(1S)-2,3-dihydro-1H-inden-1-yl]-3-methyl-2-oxopyrrolidin-3-yl]pyridine-2-carboxamide.
| Compound Name | 6-chloro-N-[(3R)-1-[(1S)-2,3-dihydro-1H-inden-1-yl]-3-methyl-2-oxopyrrolidin-3-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 57288281 |
| Molecular Formula | C20H20ClN3O2 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 6-chloro-N-[(3R)-1-[(1S)-2,3-dihydro-1H-inden-1-yl]-3-methyl-2-oxopyrrolidin-3-yl]pyridine-2-carboxamide |
| SMILES | C[C@@]1(NC(=O)c2cccc(Cl)n2)CCN([C@H]2CCc3ccccc32)C1=O |
| InChI | InChI=1S/C20H20ClN3O2/c1-20(23-18(25)15-7-4-8-17(21)22-15)11-12-24(19(20)26)16-10-9-13-5-2-3-6-14(13)16/h2-8,16H,9-12H2,1H3,(H,23,25)/t16-,20+/m0/s1 |
| InChIKey | BYFQIOKTHWUVBM-OXJNMPFZSA-N |
| XLogP | 3.14 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|