About 3-(3-iminopropyl)phenol
3-(3-iminopropyl)phenol (PubChem CID 142028665) has the molecular formula C9H11NO
and a molecular weight of 149.19 g/mol. Its IUPAC name is 3-(3-iminopropyl)phenol.
Molecular Properties
| Compound Name | 3-(3-iminopropyl)phenol |
| PubChem CID | 142028665 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 3-(3-iminopropyl)phenol |
| SMILES | [H]/N=C/CCc1cccc(O)c1 |
| InChI | InChI=1S/C9H11NO/c10-6-2-4-8-3-1-5-9(11)7-8/h1,3,5-7,10-11H,2,4H2/b10-6+ |
| InChIKey | CBYKIBNJEUWDLU-UXBLZVDNSA-N |
| XLogP | 1.97 |
| TPSA | 44.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-iminopropyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-iminopropyl)phenol?
The IUPAC name of 3-(3-iminopropyl)phenol (CID 142028665) is 3-(3-iminopropyl)phenol.
What is the SMILES notation for 3-(3-iminopropyl)phenol?
The canonical SMILES for 3-(3-iminopropyl)phenol is [H]/N=C/CCc1cccc(O)c1.
What is the InChIKey of 3-(3-iminopropyl)phenol?
The InChIKey is CBYKIBNJEUWDLU-UXBLZVDNSA-N. The full InChI is InChI=1S/C9H11NO/c10-6-2-4-8-3-1-5-9(11)7-8/h1,3,5-7,10-11H,2,4H2/b10-6+.
What are the key properties of 3-(3-iminopropyl)phenol?
3-(3-iminopropyl)phenol has a molecular weight of 149.19 g/mol, XLogP of 1.97, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-iminopropyl)phenol is sourced from PubChem (CID 142028665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).