C17H28N2O4S — CID 142028796
2-[(3-butoxy-2-hydroxypropyl)amino]-3-(2-pyridin-4-ylethylsulfanyl)propanoic acid (PubChem CID 142028796) has the molecular formula C17H28N2O4S and a molecular weight of 356.49 g/mol. Its IUPAC name is 2-[(3-butoxy-2-hydroxypropyl)amino]-3-(2-pyridin-4-ylethylsulfanyl)propanoic acid.
| Compound Name | 2-[(3-butoxy-2-hydroxypropyl)amino]-3-(2-pyridin-4-ylethylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 142028796 |
| Molecular Formula | C17H28N2O4S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | 2-[(3-butoxy-2-hydroxypropyl)amino]-3-(2-pyridin-4-ylethylsulfanyl)propanoic acid |
| SMILES | CCCCOCC(O)CNC(CSCCc1ccncc1)C(=O)O |
| InChI | InChI=1S/C17H28N2O4S/c1-2-3-9-23-12-15(20)11-19-16(17(21)22)13-24-10-6-14-4-7-18-8-5-14/h4-5,7-8,15-16,19-20H,2-3,6,9-13H2,1H3,(H,21,22) |
| InChIKey | LFYNHOYZJXXBPX-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|