C17H34N2O8S2 — CID 21026800
2-amino-3-[[2-carboxy-2-[[2-hydroxy-3-[4-(2-hydroxybutoxy)butoxy]propyl]amino]ethyl]disulfanyl]propanoic acid (PubChem CID 21026800) has the molecular formula C17H34N2O8S2 and a molecular weight of 458.60 g/mol. Its IUPAC name is 2-amino-3-[[2-carboxy-2-[[2-hydroxy-3-[4-(2-hydroxybutoxy)butoxy]propyl]amino]ethyl]disulfanyl]propanoic acid.
| Compound Name | 2-amino-3-[[2-carboxy-2-[[2-hydroxy-3-[4-(2-hydroxybutoxy)butoxy]propyl]amino]ethyl]disulfanyl]propanoic acid |
|---|---|
| PubChem CID | 21026800 |
| Molecular Formula | C17H34N2O8S2 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | 2-amino-3-[[2-carboxy-2-[[2-hydroxy-3-[4-(2-hydroxybutoxy)butoxy]propyl]amino]ethyl]disulfanyl]propanoic acid |
| SMILES | CCC(O)COCCCCOCC(O)CNC(CSSCC(N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C17H34N2O8S2/c1-2-12(20)8-26-5-3-4-6-27-9-13(21)7-19-15(17(24)25)11-29-28-10-14(18)16(22)23/h12-15,19-21H,2-11,18H2,1H3,(H,22,23)(H,24,25) |
| InChIKey | IEMXHFPEPANHQC-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 171.57 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|