C13H26N2O5S2 — CID 58607722
2-amino-4-[[3-carboxy-3-(2-hydroxybutylamino)propyl]disulfanyl]pentanoic acid (PubChem CID 58607722) has the molecular formula C13H26N2O5S2 and a molecular weight of 354.49 g/mol. Its IUPAC name is 2-amino-4-[[3-carboxy-3-(2-hydroxybutylamino)propyl]disulfanyl]pentanoic acid.
| Compound Name | 2-amino-4-[[3-carboxy-3-(2-hydroxybutylamino)propyl]disulfanyl]pentanoic acid |
|---|---|
| PubChem CID | 58607722 |
| Molecular Formula | C13H26N2O5S2 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 2-amino-4-[[3-carboxy-3-(2-hydroxybutylamino)propyl]disulfanyl]pentanoic acid |
| SMILES | CCC(O)CNC(CCSSC(C)CC(N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C13H26N2O5S2/c1-3-9(16)7-15-11(13(19)20)4-5-21-22-8(2)6-10(14)12(17)18/h8-11,15-16H,3-7,14H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | NFUPRZZSEAZWFL-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|