C12H24N2O5S2 — CID 21026805
2-amino-4-[[3-carboxy-3-(2-hydroxybutylamino)propyl]disulfanyl]butanoic acid (PubChem CID 21026805) has the molecular formula C12H24N2O5S2 and a molecular weight of 340.47 g/mol. Its IUPAC name is 2-amino-4-[[3-carboxy-3-(2-hydroxybutylamino)propyl]disulfanyl]butanoic acid.
| Compound Name | 2-amino-4-[[3-carboxy-3-(2-hydroxybutylamino)propyl]disulfanyl]butanoic acid |
|---|---|
| PubChem CID | 21026805 |
| Molecular Formula | C12H24N2O5S2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 2-amino-4-[[3-carboxy-3-(2-hydroxybutylamino)propyl]disulfanyl]butanoic acid |
| SMILES | CCC(O)CNC(CCSSCCC(N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C12H24N2O5S2/c1-2-8(15)7-14-10(12(18)19)4-6-21-20-5-3-9(13)11(16)17/h8-10,14-15H,2-7,13H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | CIRKUWJUQQLHEN-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|