C11H23N3O6S3 — CID 174858857
2-amino-4-[(3-amino-3-carboxypropyl)disulfanyl]butanoic acid;2-amino-3-sulfanylpropanoic acid (PubChem CID 174858857) has the molecular formula C11H23N3O6S3 and a molecular weight of 389.52 g/mol. Its IUPAC name is 2-amino-4-[(3-amino-3-carboxypropyl)disulfanyl]butanoic acid;2-amino-3-sulfanylpropanoic acid.
| Compound Name | 2-amino-4-[(3-amino-3-carboxypropyl)disulfanyl]butanoic acid;2-amino-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 174858857 |
| Molecular Formula | C11H23N3O6S3 |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | 2-amino-4-[(3-amino-3-carboxypropyl)disulfanyl]butanoic acid;2-amino-3-sulfanylpropanoic acid |
| SMILES | NC(CCSSCCC(N)C(=O)O)C(=O)O.NC(CS)C(=O)O |
| InChI | InChI=1S/C8H16N2O4S2.C3H7NO2S/c9-5(7(11)12)1-3-15-16-4-2-6(10)8(13)14;4-2(1-7)3(5)6/h5-6H,1-4,9-10H2,(H,11,12)(H,13,14);2,7H,1,4H2,(H,5,6) |
| InChIKey | BFSSALREOQUPNW-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 189.96 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|