C8H16N2O4S3 — CID 168727153
(2S)-2-amino-4-[[(3S)-3-amino-3-carboxypropyl]trisulfanyl]butanoic acid (PubChem CID 168727153) has the molecular formula C8H16N2O4S3 and a molecular weight of 300.43 g/mol. Its IUPAC name is (2S)-2-amino-4-[[(3S)-3-amino-3-carboxypropyl]trisulfanyl]butanoic acid.
| Compound Name | (2S)-2-amino-4-[[(3S)-3-amino-3-carboxypropyl]trisulfanyl]butanoic acid |
|---|---|
| PubChem CID | 168727153 |
| Molecular Formula | C8H16N2O4S3 |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | (2S)-2-amino-4-[[(3S)-3-amino-3-carboxypropyl]trisulfanyl]butanoic acid |
| SMILES | N[C@@H](CCSSSCC[C@H](N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C8H16N2O4S3/c9-5(7(11)12)1-3-15-17-16-4-2-6(10)8(13)14/h5-6H,1-4,9-10H2,(H,11,12)(H,13,14)/t5-,6-/m0/s1 |
| InChIKey | KCGJJUWDVYWPRO-WDSKDSINSA-N |
| XLogP | 0.62 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|