C17H21NO3 — CID 142029441
(E)-1-(7-methoxy-1-benzofuran-2-yl)-2-methyl-N-prop-1-en-2-yloxybutan-1-imine (PubChem CID 142029441) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is (E)-1-(7-methoxy-1-benzofuran-2-yl)-2-methyl-N-prop-1-en-2-yloxybutan-1-imine.
| Compound Name | (E)-1-(7-methoxy-1-benzofuran-2-yl)-2-methyl-N-prop-1-en-2-yloxybutan-1-imine |
|---|---|
| PubChem CID | 142029441 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | (E)-1-(7-methoxy-1-benzofuran-2-yl)-2-methyl-N-prop-1-en-2-yloxybutan-1-imine |
| SMILES | C=C(C)O/N=C(/c1cc2cccc(OC)c2o1)C(C)CC |
| InChI | InChI=1S/C17H21NO3/c1-6-12(4)16(18-21-11(2)3)15-10-13-8-7-9-14(19-5)17(13)20-15/h7-10,12H,2,6H2,1,3-5H3/b18-16+ |
| InChIKey | LCVHEKJLLOMEBN-FBMGVBCBSA-N |
| XLogP | 4.74 |
| TPSA | 43.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|