C5H9N3 — CID 142030297
6-methyl-1,4-dihydropyrimidin-5-amine (PubChem CID 142030297) has the molecular formula C5H9N3 and a molecular weight of 111.15 g/mol. Its IUPAC name is 6-methyl-1,4-dihydropyrimidin-5-amine.
| Compound Name | 6-methyl-1,4-dihydropyrimidin-5-amine |
|---|---|
| PubChem CID | 142030297 |
| Molecular Formula | C5H9N3 |
| Molecular Weight | 111.15 g/mol |
| Exact Mass | 111.08 |
| IUPAC Name | 6-methyl-1,4-dihydropyrimidin-5-amine |
| SMILES | CC1=C(N)CN=CN1 |
| InChI | InChI=1S/C5H9N3/c1-4-5(6)2-7-3-8-4/h3H,2,6H2,1H3,(H,7,8) |
| InChIKey | JMQRCQPAABGWHJ-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 111.15 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |