About 4-(N,2-diamino-4-methylanilino)-N-[(1S)-1-phenylethyl]pyrimidin-2-amine
4-(N,2-diamino-4-methylanilino)-N-[(1S)-1-phenylethyl]pyrimidin-2-amine (PubChem CID 142035617) has the molecular formula C19H22N6
and a molecular weight of 334.43 g/mol. Its IUPAC name is 4-(N,2-diamino-4-methylanilino)-N-[(1S)-1-phenylethyl]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-(N,2-diamino-4-methylanilino)-N-[(1S)-1-phenylethyl]pyrimidin-2-amine |
| PubChem CID | 142035617 |
| Molecular Formula | C19H22N6 |
| Molecular Weight | 334.43 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 4-(N,2-diamino-4-methylanilino)-N-[(1S)-1-phenylethyl]pyrimidin-2-amine |
| SMILES | Cc1ccc(N(N)c2ccnc(N[C@@H](C)c3ccccc3)n2)c(N)c1 |
| InChI | InChI=1S/C19H22N6/c1-13-8-9-17(16(20)12-13)25(21)18-10-11-22-19(24-18)23-14(2)15-6-4-3-5-7-15/h3-12,14H,20-21H2,1-2H3,(H,22,23,24)/t14-/m0/s1 |
| InChIKey | AQVMUNRXYCPOIE-AWEZNQCLSA-N |
| XLogP | 3.55 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.43 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(N,2-diamino-4-methylanilino)-N-[(1S)-1-phenylethyl]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(N,2-diamino-4-methylanilino)-N-[(1S)-1-phenylethyl]pyrimidin-2-amine?
The IUPAC name of 4-(N,2-diamino-4-methylanilino)-N-[(1S)-1-phenylethyl]pyrimidin-2-amine (CID 142035617) is 4-(N,2-diamino-4-methylanilino)-N-[(1S)-1-phenylethyl]pyrimidin-2-amine.
What is the SMILES notation for 4-(N,2-diamino-4-methylanilino)-N-[(1S)-1-phenylethyl]pyrimidin-2-amine?
The canonical SMILES for 4-(N,2-diamino-4-methylanilino)-N-[(1S)-1-phenylethyl]pyrimidin-2-amine is Cc1ccc(N(N)c2ccnc(N[C@@H](C)c3ccccc3)n2)c(N)c1.
What is the InChIKey of 4-(N,2-diamino-4-methylanilino)-N-[(1S)-1-phenylethyl]pyrimidin-2-amine?
The InChIKey is AQVMUNRXYCPOIE-AWEZNQCLSA-N. The full InChI is InChI=1S/C19H22N6/c1-13-8-9-17(16(20)12-13)25(21)18-10-11-22-19(24-18)23-14(2)15-6-4-3-5-7-15/h3-12,14H,20-21H2,1-2H3,(H,22,23,24)/t14-/m0/s1.
What are the key properties of 4-(N,2-diamino-4-methylanilino)-N-[(1S)-1-phenylethyl]pyrimidin-2-amine?
4-(N,2-diamino-4-methylanilino)-N-[(1S)-1-phenylethyl]pyrimidin-2-amine has a molecular weight of 334.43 g/mol, XLogP of 3.55, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(N,2-diamino-4-methylanilino)-N-[(1S)-1-phenylethyl]pyrimidin-2-amine is sourced from PubChem (CID 142035617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).