C22H26 — CID 142037579
2,4-dimethyl-1-[(1E,3Z)-2-methyl-1-(2-methylphenyl)hexa-1,3-dien-3-yl]benzene (PubChem CID 142037579) has the molecular formula C22H26 and a molecular weight of 290.45 g/mol. Its IUPAC name is 2,4-dimethyl-1-[(1E,3Z)-2-methyl-1-(2-methylphenyl)hexa-1,3-dien-3-yl]benzene.
| Compound Name | 2,4-dimethyl-1-[(1E,3Z)-2-methyl-1-(2-methylphenyl)hexa-1,3-dien-3-yl]benzene |
|---|---|
| PubChem CID | 142037579 |
| Molecular Formula | C22H26 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 2,4-dimethyl-1-[(1E,3Z)-2-methyl-1-(2-methylphenyl)hexa-1,3-dien-3-yl]benzene |
| SMILES | CC/C=C(C(/C)=C/c1ccccc1C)\c1ccc(C)cc1C |
| InChI | InChI=1S/C22H26/c1-6-9-21(22-13-12-16(2)14-18(22)4)19(5)15-20-11-8-7-10-17(20)3/h7-15H,6H2,1-5H3/b19-15+,21-9- |
| InChIKey | JAHXJUNTJFCEAE-QKVZUXMZSA-N |
| XLogP | 6.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|