C25H26 — CID 142129554
1-[(1E,3Z)-2,3-dimethyl-4-(2-methylphenyl)buta-1,3-dienyl]-2,3-dimethylnaphthalene (PubChem CID 142129554) has the molecular formula C25H26 and a molecular weight of 326.48 g/mol. Its IUPAC name is 1-[(1E,3Z)-2,3-dimethyl-4-(2-methylphenyl)buta-1,3-dienyl]-2,3-dimethylnaphthalene.
| Compound Name | 1-[(1E,3Z)-2,3-dimethyl-4-(2-methylphenyl)buta-1,3-dienyl]-2,3-dimethylnaphthalene |
|---|---|
| PubChem CID | 142129554 |
| Molecular Formula | C25H26 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 1-[(1E,3Z)-2,3-dimethyl-4-(2-methylphenyl)buta-1,3-dienyl]-2,3-dimethylnaphthalene |
| SMILES | CC(=C/c1ccccc1C)/C(C)=C/c1c(C)c(C)cc2ccccc12 |
| InChI | InChI=1S/C25H26/c1-17-10-6-7-11-22(17)14-18(2)19(3)16-25-21(5)20(4)15-23-12-8-9-13-24(23)25/h6-16H,1-5H3/b18-14-,19-16+ |
| InChIKey | OARDXDZWUYFABH-PVOXQVLESA-N |
| XLogP | 7.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|