C27H33N2O5S+ — CID 142038793
CID 142038793 (PubChem CID 142038793) has the molecular formula C27H33N2O5S+ and a molecular weight of 497.64 g/mol.
| Compound Name | CID 142038793 |
|---|---|
| PubChem CID | 142038793 |
| Molecular Formula | C27H33N2O5S+ |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | — |
| SMILES | CC1=C(C(=O)OCCN(C)Cc2ccccc2)C(c2ccccc2C)C2=C(COCC[S+]2(=O)O)N1 |
| InChI | InChI=1S/C27H32N2O5S/c1-19-9-7-8-12-22(19)25-24(20(2)28-23-18-33-15-16-35(31,32)26(23)25)27(30)34-14-13-29(3)17-21-10-5-4-6-11-21/h4-12,25H,13-18H2,1-3H3,(H-,28,30,31,32)/p+1 |
| InChIKey | NNPAXMGAOHYAFB-UHFFFAOYSA-O |
| XLogP | 3.85 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|