C16H26N5O4+ — CID 142039106
[N-ethanimidoyl-C-[3-[[4-[(2S)-1-ethoxy-1-oxobutan-2-yl]-3-oxopyrazin-2-yl]amino]propyl]carbonimidoyl]oxidanium (PubChem CID 142039106) has the molecular formula C16H26N5O4+ and a molecular weight of 352.42 g/mol. Its IUPAC name is [N-ethanimidoyl-C-[3-[[4-[(2S)-1-ethoxy-1-oxobutan-2-yl]-3-oxopyrazin-2-yl]amino]propyl]carbonimidoyl]oxidanium.
| Compound Name | [N-ethanimidoyl-C-[3-[[4-[(2S)-1-ethoxy-1-oxobutan-2-yl]-3-oxopyrazin-2-yl]amino]propyl]carbonimidoyl]oxidanium |
|---|---|
| PubChem CID | 142039106 |
| Molecular Formula | C16H26N5O4+ |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | [N-ethanimidoyl-C-[3-[[4-[(2S)-1-ethoxy-1-oxobutan-2-yl]-3-oxopyrazin-2-yl]amino]propyl]carbonimidoyl]oxidanium |
| SMILES | [H]/N=C(C)/N=C(\[OH2+])CCCNc1nccn([C@@H](CC)C(=O)OCC)c1=O |
| InChI | InChI=1S/C16H25N5O4/c1-4-12(16(24)25-5-2)21-10-9-19-14(15(21)23)18-8-6-7-13(22)20-11(3)17/h9-10,12H,4-8H2,1-3H3,(H,18,19)(H2,17,20,22)/p+1/t12-/m0/s1 |
| InChIKey | OOULFRFAEAZHNW-LBPRGKRZSA-O |
| XLogP | 1.07 |
| TPSA | 132.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|