C15H21N5O3 — CID 22969698
3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propylamino]-1-(2-oxopentan-3-yl)pyrazin-2-one (PubChem CID 22969698) has the molecular formula C15H21N5O3 and a molecular weight of 319.37 g/mol. Its IUPAC name is 3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propylamino]-1-(2-oxopentan-3-yl)pyrazin-2-one.
| Compound Name | 3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propylamino]-1-(2-oxopentan-3-yl)pyrazin-2-one |
|---|---|
| PubChem CID | 22969698 |
| Molecular Formula | C15H21N5O3 |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propylamino]-1-(2-oxopentan-3-yl)pyrazin-2-one |
| SMILES | CCC(C(C)=O)n1ccnc(NCCCc2nc(C)no2)c1=O |
| InChI | InChI=1S/C15H21N5O3/c1-4-12(10(2)21)20-9-8-17-14(15(20)22)16-7-5-6-13-18-11(3)19-23-13/h8-9,12H,4-7H2,1-3H3,(H,16,17) |
| InChIKey | CAQIOBXMYPLKCV-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 102.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|