C16H23N5O4 — CID 59909392
ethyl (2S)-2-[3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propylamino]-2-oxopyrazin-1-yl]butanoate (PubChem CID 59909392) has the molecular formula C16H23N5O4 and a molecular weight of 349.39 g/mol. Its IUPAC name is ethyl (2S)-2-[3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propylamino]-2-oxopyrazin-1-yl]butanoate.
| Compound Name | ethyl (2S)-2-[3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propylamino]-2-oxopyrazin-1-yl]butanoate |
|---|---|
| PubChem CID | 59909392 |
| Molecular Formula | C16H23N5O4 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | ethyl (2S)-2-[3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propylamino]-2-oxopyrazin-1-yl]butanoate |
| SMILES | CCOC(=O)[C@H](CC)n1ccnc(NCCCc2nc(C)no2)c1=O |
| InChI | InChI=1S/C16H23N5O4/c1-4-12(16(23)24-5-2)21-10-9-18-14(15(21)22)17-8-6-7-13-19-11(3)20-25-13/h9-10,12H,4-8H2,1-3H3,(H,17,18)/t12-/m0/s1 |
| InChIKey | WDZGINPMCXDSGF-LBPRGKRZSA-N |
| XLogP | 1.49 |
| TPSA | 112.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|