C16H25N5O5 — CID 142041874
N-methoxy-N-methyl-2-methylidene-5,8,11-trioxo-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-6-carboxamide (PubChem CID 142041874) has the molecular formula C16H25N5O5 and a molecular weight of 367.41 g/mol. Its IUPAC name is N-methoxy-N-methyl-2-methylidene-5,8,11-trioxo-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-6-carboxamide.
| Compound Name | N-methoxy-N-methyl-2-methylidene-5,8,11-trioxo-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-6-carboxamide |
|---|---|
| PubChem CID | 142041874 |
| Molecular Formula | C16H25N5O5 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | N-methoxy-N-methyl-2-methylidene-5,8,11-trioxo-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-6-carboxamide |
| SMILES | C=C1CNC(=O)C(C(=O)N(C)OC)NC(=O)CNC(=O)C2CCCCN12 |
| InChI | InChI=1S/C16H25N5O5/c1-10-8-17-15(24)13(16(25)20(2)26-3)19-12(22)9-18-14(23)11-6-4-5-7-21(10)11/h11,13H,1,4-9H2,2-3H3,(H,17,24)(H,18,23)(H,19,22) |
| InChIKey | JTCZPEANZZNWKN-UHFFFAOYSA-N |
| XLogP | -1.89 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|