C13H20N4O4 — CID 142041929
7-hydroxy-2-methylidene-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-5,8,11-trione (PubChem CID 142041929) has the molecular formula C13H20N4O4 and a molecular weight of 296.33 g/mol. Its IUPAC name is 7-hydroxy-2-methylidene-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-5,8,11-trione.
| Compound Name | 7-hydroxy-2-methylidene-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-5,8,11-trione |
|---|---|
| PubChem CID | 142041929 |
| Molecular Formula | C13H20N4O4 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 7-hydroxy-2-methylidene-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-5,8,11-trione |
| SMILES | C=C1CNC(=O)CN(O)C(=O)CNC(=O)C2CCCCN12 |
| InChI | InChI=1S/C13H20N4O4/c1-9-6-14-11(18)8-17(21)12(19)7-15-13(20)10-4-2-3-5-16(9)10/h10,21H,1-8H2,(H,14,18)(H,15,20) |
| InChIKey | PILBJVSXVKNURU-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|